C15H24BrClN2O — CID 2902956
N-(4-bromo-3-methylphenyl)-3-[butyl(methyl)amino]propanamide;hydrochloride (PubChem CID 2902956) has the molecular formula C15H24BrClN2O and a molecular weight of 363.73 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-3-[butyl(methyl)amino]propanamide;hydrochloride.
| Compound Name | N-(4-bromo-3-methylphenyl)-3-[butyl(methyl)amino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 2902956 |
| Molecular Formula | C15H24BrClN2O |
| Molecular Weight | 363.73 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-3-[butyl(methyl)amino]propanamide;hydrochloride |
| SMILES | CCCCN(C)CCC(=O)Nc1ccc(Br)c(C)c1.Cl |
| InChI | InChI=1S/C15H23BrN2O.ClH/c1-4-5-9-18(3)10-8-15(19)17-13-6-7-14(16)12(2)11-13;/h6-7,11H,4-5,8-10H2,1-3H3,(H,17,19);1H |
| InChIKey | AQOXKBYBAPYLAT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |