C14H21BrN2O — CID 109006163
N-(4-bromo-3-methylphenyl)-2-[butyl(methyl)amino]acetamide (PubChem CID 109006163) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[butyl(methyl)amino]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[butyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 109006163 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[butyl(methyl)amino]acetamide |
| SMILES | CCCCN(C)CC(=O)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C14H21BrN2O/c1-4-5-8-17(3)10-14(18)16-12-6-7-13(15)11(2)9-12/h6-7,9H,4-5,8,10H2,1-3H3,(H,16,18) |
| InChIKey | OQSJIVCLDCWQFE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |