C47H80N4O2 — CID 139955611
4-[octyl(pentyl)amino]-N-[4-[[4-[4-[octyl(pentyl)amino]butanoylamino]phenyl]methyl]phenyl]butanamide (PubChem CID 139955611) has the molecular formula C47H80N4O2 and a molecular weight of 733.18 g/mol. Its IUPAC name is 4-[octyl(pentyl)amino]-N-[4-[[4-[4-[octyl(pentyl)amino]butanoylamino]phenyl]methyl]phenyl]butanamide.
| Compound Name | 4-[octyl(pentyl)amino]-N-[4-[[4-[4-[octyl(pentyl)amino]butanoylamino]phenyl]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 139955611 |
| Molecular Formula | C47H80N4O2 |
| Molecular Weight | 733.18 g/mol |
| Exact Mass | 732.63 |
| IUPAC Name | 4-[octyl(pentyl)amino]-N-[4-[[4-[4-[octyl(pentyl)amino]butanoylamino]phenyl]methyl]phenyl]butanamide |
| SMILES | CCCCCCCCN(CCCCC)CCCC(=O)Nc1ccc(Cc2ccc(NC(=O)CCCN(CCCCC)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C47H80N4O2/c1-5-9-13-15-17-21-37-50(35-19-11-7-3)39-23-25-46(52)48-44-31-27-42(28-32-44)41-43-29-33-45(34-30-43)49-47(53)26-24-40-51(36-20-12-8-4)38-22-18-16-14-10-6-2/h27-34H,5-26,35-41H2,1-4H3,(H,48,52)(H,49,53) |
| InChIKey | YJMMNZNVPJZMDN-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.18 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|