C30H38N4O4+2 — CID 10628996
3-(1-methylpyrrolidin-1-ium-1-yl)-N-[7-[3-(1-methylpyrrolidin-1-ium-1-yl)propanoylamino]-9,10-dioxoanthracen-2-yl]propanamide (PubChem CID 10628996) has the molecular formula C30H38N4O4+2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 3-(1-methylpyrrolidin-1-ium-1-yl)-N-[7-[3-(1-methylpyrrolidin-1-ium-1-yl)propanoylamino]-9,10-dioxoanthracen-2-yl]propanamide.
| Compound Name | 3-(1-methylpyrrolidin-1-ium-1-yl)-N-[7-[3-(1-methylpyrrolidin-1-ium-1-yl)propanoylamino]-9,10-dioxoanthracen-2-yl]propanamide |
|---|---|
| PubChem CID | 10628996 |
| Molecular Formula | C30H38N4O4+2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 3-(1-methylpyrrolidin-1-ium-1-yl)-N-[7-[3-(1-methylpyrrolidin-1-ium-1-yl)propanoylamino]-9,10-dioxoanthracen-2-yl]propanamide |
| SMILES | C[N+]1(CCC(=O)Nc2ccc3c(c2)C(=O)c2cc(NC(=O)CC[N+]4(C)CCCC4)ccc2C3=O)CCCC1 |
| InChI | InChI=1S/C30H36N4O4/c1-33(13-3-4-14-33)17-11-27(35)31-21-7-9-23-25(19-21)30(38)26-20-22(8-10-24(26)29(23)37)32-28(36)12-18-34(2)15-5-6-16-34/h7-10,19-20H,3-6,11-18H2,1-2H3/p+2 |
| InChIKey | VGLMKBBLPKDZQV-UHFFFAOYSA-P |
| XLogP | 3.60 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|