C56H42N2O12 — CID 123611970
N-[(2Z)-2-[(2E,4E)-5-[3-hydroxy-1-oxo-5-(2-oxopropyl)inden-2-yl]penta-2,4-dienylidene]-1,3-dioxoinden-5-yl]acetamide (PubChem CID 123611970) has the molecular formula C56H42N2O12 and a molecular weight of 934.95 g/mol. Its IUPAC name is N-[(2Z)-2-[(2E,4E)-5-[3-hydroxy-1-oxo-5-(2-oxopropyl)inden-2-yl]penta-2,4-dienylidene]-1,3-dioxoinden-5-yl]acetamide.
| Compound Name | N-[(2Z)-2-[(2E,4E)-5-[3-hydroxy-1-oxo-5-(2-oxopropyl)inden-2-yl]penta-2,4-dienylidene]-1,3-dioxoinden-5-yl]acetamide |
|---|---|
| PubChem CID | 123611970 |
| Molecular Formula | C56H42N2O12 |
| Molecular Weight | 934.95 g/mol |
| Exact Mass | 934.27 |
| IUPAC Name | N-[(2Z)-2-[(2E,4E)-5-[3-hydroxy-1-oxo-5-(2-oxopropyl)inden-2-yl]penta-2,4-dienylidene]-1,3-dioxoinden-5-yl]acetamide |
| SMILES | CC(=O)Cc1ccc2c(c1)C(O)=C(/C=C/C=C/C=C1/C(=O)c3ccc(NC(C)=O)cc3C1=O)C2=O.CC(=O)Cc1ccc2c(c1)C(O)=C(/C=C/C=C/C=C1/C(=O)c3ccc(NC(C)=O)cc3C1=O)C2=O |
| InChI | InChI=1S/2C28H21NO6/c2*1-15(30)12-17-8-10-19-23(13-17)27(34)21(25(19)32)6-4-3-5-7-22-26(33)20-11-9-18(29-16(2)31)14-24(20)28(22)35/h2*3-11,13-14,34H,12H2,1-2H3,(H,29,31)/b2*5-3+,6-4+,22-7- |
| InChIKey | HYBQISIGNZDCBT-AWZJJLBJSA-N |
| XLogP | 8.72 |
| TPSA | 235.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.95 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|