C10H8N2O4 — CID 100916426
N-(2-hydroxy-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 100916426) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is N-(2-hydroxy-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | N-(2-hydroxy-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 100916426 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | N-(2-hydroxy-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)C(=O)N(O)C2=O |
| InChI | InChI=1S/C10H8N2O4/c1-5(13)11-6-2-3-7-8(4-6)10(15)12(16)9(7)14/h2-4,16H,1H3,(H,11,13) |
| InChIKey | OFBPVBUBJSENAS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|