C21H20N4O5 — CID 159636176
aniline;N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]acetamide (PubChem CID 159636176) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is aniline;N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]acetamide.
| Compound Name | aniline;N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 159636176 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | aniline;N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O.Nc1ccccc1 |
| InChI | InChI=1S/C15H13N3O5.C6H7N/c1-7(19)16-8-2-3-9-10(6-8)15(23)18(14(9)22)11-4-5-12(20)17-13(11)21;7-6-4-2-1-3-5-6/h2-3,6,11H,4-5H2,1H3,(H,16,19)(H,17,20,21);1-5H,7H2 |
| InChIKey | MPTRZPHVKVASLU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|