C23H20ClN3O5 — CID 166426870
2-(2-chlorophenyl)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methylpropanamide (PubChem CID 166426870) has the molecular formula C23H20ClN3O5 and a molecular weight of 453.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methylpropanamide.
| Compound Name | 2-(2-chlorophenyl)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 166426870 |
| Molecular Formula | C23H20ClN3O5 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H20ClN3O5/c1-23(2,15-5-3-4-6-16(15)24)22(32)25-12-7-8-13-14(11-12)21(31)27(20(13)30)17-9-10-18(28)26-19(17)29/h3-8,11,17H,9-10H2,1-2H3,(H,25,32)(H,26,28,29) |
| InChIKey | ITURSFCCQXIHII-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|