C24H19N3O7 — CID 171393695
methyl 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]carbamoyl]cubane-1-carboxylate (PubChem CID 171393695) has the molecular formula C24H19N3O7 and a molecular weight of 461.43 g/mol. Its IUPAC name is methyl 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]carbamoyl]cubane-1-carboxylate.
| Compound Name | methyl 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]carbamoyl]cubane-1-carboxylate |
|---|---|
| PubChem CID | 171393695 |
| Molecular Formula | C24H19N3O7 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | methyl 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]carbamoyl]cubane-1-carboxylate |
| SMILES | COC(=O)C12C3C4C1C1C2C3C41C(=O)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H19N3O7/c1-34-22(33)24-15-12-16(24)14-17(24)13(15)23(12,14)21(32)25-7-2-3-8-9(6-7)20(31)27(19(8)30)10-4-5-11(28)26-18(10)29/h2-3,6,10,12-17H,4-5H2,1H3,(H,25,32)(H,26,28,29) |
| InChIKey | SGTTVTPORCPSDX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|