C18H20N4O6 — CID 175271647
2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]propanamide (PubChem CID 175271647) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]propanamide.
| Compound Name | 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]propanamide |
|---|---|
| PubChem CID | 175271647 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]propanamide |
| SMILES | CC(OCCNc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)C(N)=O |
| InChI | InChI=1S/C18H20N4O6/c1-9(15(19)24)28-7-6-20-10-2-3-11-12(8-10)18(27)22(17(11)26)13-4-5-14(23)21-16(13)25/h2-3,8-9,13,20H,4-7H2,1H3,(H2,19,24)(H,21,23,25) |
| InChIKey | FAKMAPWQGMTSKN-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|