C21H26IN3O7 — CID 139402582
2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethylamino]isoindole-1,3-dione (PubChem CID 139402582) has the molecular formula C21H26IN3O7 and a molecular weight of 559.36 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139402582 |
| Molecular Formula | C21H26IN3O7 |
| Molecular Weight | 559.36 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCOCCOCCOCCI)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H26IN3O7/c22-5-7-30-9-11-32-12-10-31-8-6-23-14-1-2-15-16(13-14)21(29)25(20(15)28)17-3-4-18(26)24-19(17)27/h1-2,13,17,23H,3-12H2,(H,24,26,27) |
| InChIKey | KRSNDHCDJHQGEF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|