C26H36N6O5 — CID 167462851
2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-(4-piperidin-4-ylpiperazin-1-yl)ethoxy]ethylamino]isoindole-1,3-dione (PubChem CID 167462851) has the molecular formula C26H36N6O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-(4-piperidin-4-ylpiperazin-1-yl)ethoxy]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-(4-piperidin-4-ylpiperazin-1-yl)ethoxy]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167462851 |
| Molecular Formula | C26H36N6O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-(4-piperidin-4-ylpiperazin-1-yl)ethoxy]ethylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCOCCN4CCN(C5CCNCC5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H36N6O5/c33-23-4-3-22(24(34)29-23)32-25(35)20-2-1-18(17-21(20)26(32)36)28-9-15-37-16-14-30-10-12-31(13-11-30)19-5-7-27-8-6-19/h1-2,17,19,22,27-28H,3-16H2,(H,29,33,34) |
| InChIKey | NCDVYPMBBCBGIN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|