C24H26F3N3O11 — CID 156811854
(2,2,2-trifluoroacetyl) 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]propaneperoxoate (PubChem CID 156811854) has the molecular formula C24H26F3N3O11 and a molecular weight of 589.48 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]propaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]propaneperoxoate |
|---|---|
| PubChem CID | 156811854 |
| Molecular Formula | C24H26F3N3O11 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]propaneperoxoate |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCOCCOCCOCCC(=O)OOC(=O)C(F)(F)F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H26F3N3O11/c25-24(26,27)23(36)41-40-19(32)5-7-37-9-11-39-12-10-38-8-6-28-14-1-2-15-16(13-14)22(35)30(21(15)34)17-3-4-18(31)29-20(17)33/h1-2,13,17,28H,3-12H2,(H,29,31,33) |
| InChIKey | YEESLMXKHVDFJT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 175.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|