C24H32N4O6 — CID 175555570
10-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]decyl carbamate (PubChem CID 175555570) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 10-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]decyl carbamate.
| Compound Name | 10-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]decyl carbamate |
|---|---|
| PubChem CID | 175555570 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 10-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]decyl carbamate |
| SMILES | NC(=O)OCCCCCCCCCCNc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H32N4O6/c25-24(33)34-14-8-6-4-2-1-3-5-7-13-26-16-9-10-17-18(15-16)23(32)28(22(17)31)19-11-12-20(29)27-21(19)30/h9-10,15,19,26H,1-8,11-14H2,(H2,25,33)(H,27,29,30) |
| InChIKey | NYNKAMBJRAJOST-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|