C35H24O4 — CID 23638404
2-[(2E,4E,6E)-7-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)-3,5-dimethylhepta-2,4,6-trienylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 23638404) has the molecular formula C35H24O4 and a molecular weight of 508.57 g/mol. Its IUPAC name is 2-[(2E,4E,6E)-7-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)-3,5-dimethylhepta-2,4,6-trienylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(2E,4E,6E)-7-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)-3,5-dimethylhepta-2,4,6-trienylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 23638404 |
| Molecular Formula | C35H24O4 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 2-[(2E,4E,6E)-7-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)-3,5-dimethylhepta-2,4,6-trienylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | CC(=C\C=C1C(=O)c2cc3ccccc3cc2C1=O)/C=C(C)/C=C/C1=C(O)c2cc3ccccc3cc2C1=O |
| InChI | InChI=1S/C35H24O4/c1-20(11-13-26-32(36)28-16-22-7-3-4-8-23(22)17-29(28)33(26)37)15-21(2)12-14-27-34(38)30-18-24-9-5-6-10-25(24)19-31(30)35(27)39/h3-19,36H,1-2H3/b13-11+,20-15+,21-12+ |
| InChIKey | NYAUGCFIUDIOEL-LEODPXQOSA-N |
| XLogP | 7.91 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|