C33H19ClO4 — CID 72612034
2-[[2-chloro-3-[(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)methylidene]cyclopenten-1-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 72612034) has the molecular formula C33H19ClO4 and a molecular weight of 514.96 g/mol. Its IUPAC name is 2-[[2-chloro-3-[(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)methylidene]cyclopenten-1-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[2-chloro-3-[(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)methylidene]cyclopenten-1-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 72612034 |
| Molecular Formula | C33H19ClO4 |
| Molecular Weight | 514.96 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 2-[[2-chloro-3-[(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)methylidene]cyclopenten-1-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=CC2=C(Cl)C(=CC3=C(O)c4cc5ccccc5cc4C3=O)CC2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C33H19ClO4/c34-29-21(15-27-30(35)23-11-17-5-1-2-6-18(17)12-24(23)31(27)36)9-10-22(29)16-28-32(37)25-13-19-7-3-4-8-20(19)14-26(25)33(28)38/h1-8,11-16,35H,9-10H2 |
| InChIKey | COPJCEIKCRMJDQ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.96 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|