C27H14ClO4- — CID 18737723
2-[(1E,3E)-3-chloro-5-(1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxocyclopenta[b]naphthalen-1-olate (PubChem CID 18737723) has the molecular formula C27H14ClO4- and a molecular weight of 437.86 g/mol. Its IUPAC name is 2-[(1E,3E)-3-chloro-5-(1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxocyclopenta[b]naphthalen-1-olate.
| Compound Name | 2-[(1E,3E)-3-chloro-5-(1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxocyclopenta[b]naphthalen-1-olate |
|---|---|
| PubChem CID | 18737723 |
| Molecular Formula | C27H14ClO4- |
| Molecular Weight | 437.86 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 2-[(1E,3E)-3-chloro-5-(1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxocyclopenta[b]naphthalen-1-olate |
| SMILES | O=C1C(=C/C=C(Cl)\C=C\C2=C([O-])c3cc4ccccc4cc3C2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C27H15ClO4/c28-17(9-11-20-24(29)18-7-3-4-8-19(18)25(20)30)10-12-21-26(31)22-13-15-5-1-2-6-16(15)14-23(22)27(21)32/h1-14,31H/p-1/b12-10+,17-9+ |
| InChIKey | RGMYRMJNINBQKR-ZZQRRNIXSA-M |
| XLogP | 4.79 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.86 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|