C12H6Cl2O2 — CID 121011303
2-(3,3-dichloroprop-2-enylidene)indene-1,3-dione (PubChem CID 121011303) has the molecular formula C12H6Cl2O2 and a molecular weight of 253.08 g/mol. Its IUPAC name is 2-(3,3-dichloroprop-2-enylidene)indene-1,3-dione.
| Compound Name | 2-(3,3-dichloroprop-2-enylidene)indene-1,3-dione |
|---|---|
| PubChem CID | 121011303 |
| Molecular Formula | C12H6Cl2O2 |
| Molecular Weight | 253.08 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | 2-(3,3-dichloroprop-2-enylidene)indene-1,3-dione |
| SMILES | O=C1C(=CC=C(Cl)Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C12H6Cl2O2/c13-10(14)6-5-9-11(15)7-3-1-2-4-8(7)12(9)16/h1-6H |
| InChIKey | JXWSQMQTEYXDNS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|