About sodium;fluoren-9-one;hydride
sodium;fluoren-9-one;hydride (PubChem CID 174594472) has the molecular formula C13H9NaO
and a molecular weight of 204.20 g/mol. Its IUPAC name is sodium;fluoren-9-one;hydride.
Molecular Properties
| Compound Name | sodium;fluoren-9-one;hydride |
| PubChem CID | 174594472 |
| Molecular Formula | C13H9NaO |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | sodium;fluoren-9-one;hydride |
| SMILES | O=C1c2ccccc2-c2ccccc21.[H-].[Na+] |
| InChI | InChI=1S/C13H8O.Na.H/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;;/h1-8H;;/q;+1;-1 |
| InChIKey | WWCNDRSCWRHWHP-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;fluoren-9-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;fluoren-9-one;hydride?
The IUPAC name of sodium;fluoren-9-one;hydride (CID 174594472) is sodium;fluoren-9-one;hydride.
What is the SMILES notation for sodium;fluoren-9-one;hydride?
The canonical SMILES for sodium;fluoren-9-one;hydride is O=C1c2ccccc2-c2ccccc21.[H-].[Na+].
What is the InChIKey of sodium;fluoren-9-one;hydride?
The InChIKey is WWCNDRSCWRHWHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O.Na.H/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;;/h1-8H;;/q;+1;-1.
What are the key properties of sodium;fluoren-9-one;hydride?
sodium;fluoren-9-one;hydride has a molecular weight of 204.20 g/mol, XLogP of 0.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;fluoren-9-one;hydride is sourced from PubChem (CID 174594472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).