About anthracene-9,10-dione;platinum(2+);dichloride
anthracene-9,10-dione;platinum(2+);dichloride (PubChem CID 174702138) has the molecular formula C14H8Cl2O2Pt
and a molecular weight of 474.20 g/mol. Its IUPAC name is anthracene-9,10-dione;platinum(2+);dichloride.
Molecular Properties
| Compound Name | anthracene-9,10-dione;platinum(2+);dichloride |
| PubChem CID | 174702138 |
| Molecular Formula | C14H8Cl2O2Pt |
| Molecular Weight | 474.20 g/mol |
| Exact Mass | 472.95 |
| IUPAC Name | anthracene-9,10-dione;platinum(2+);dichloride |
| SMILES | O=C1c2ccccc2C(=O)c2ccccc21.[Cl-].[Cl-].[Pt+2] |
| InChI | InChI=1S/C14H8O2.2ClH.Pt/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;;;/h1-8H;2*1H;/q;;;+2/p-2 |
| InChIKey | FWYSEXBOCFRQRG-UHFFFAOYSA-L |
| XLogP | -3.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.20 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dione;platinum(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dione;platinum(2+);dichloride?
The IUPAC name of anthracene-9,10-dione;platinum(2+);dichloride (CID 174702138) is anthracene-9,10-dione;platinum(2+);dichloride.
What is the SMILES notation for anthracene-9,10-dione;platinum(2+);dichloride?
The canonical SMILES for anthracene-9,10-dione;platinum(2+);dichloride is O=C1c2ccccc2C(=O)c2ccccc21.[Cl-].[Cl-].[Pt+2].
What is the InChIKey of anthracene-9,10-dione;platinum(2+);dichloride?
The InChIKey is FWYSEXBOCFRQRG-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H8O2.2ClH.Pt/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;;;/h1-8H;2*1H;/q;;;+2/p-2.
What are the key properties of anthracene-9,10-dione;platinum(2+);dichloride?
anthracene-9,10-dione;platinum(2+);dichloride has a molecular weight of 474.20 g/mol, XLogP of -3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dione;platinum(2+);dichloride is sourced from PubChem (CID 174702138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).