About 9,10-Phenanthrenedione
9,10-Phenanthrenedione (PubChem CID 6763) has the molecular formula C14H8O2
and a molecular weight of 208.21 g/mol. Its IUPAC name is phenanthrene-9,10-dione.
Molecular Properties
| Compound Name | 9,10-Phenanthrenedione |
| PubChem CID | 6763 |
| Molecular Formula | C14H8O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | phenanthrene-9,10-dione |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O |
| InChI | InChI=1S/C14H8O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8H |
| InChIKey | YYVYAPXYZVYDHN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | 289 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 9,10-Phenanthrenedione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-Phenanthrenedione?
The IUPAC name of 9,10-Phenanthrenedione (CID 6763) is phenanthrene-9,10-dione.
What is the SMILES notation for 9,10-Phenanthrenedione?
The canonical SMILES for 9,10-Phenanthrenedione is C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O.
What is the InChIKey of 9,10-Phenanthrenedione?
The InChIKey is YYVYAPXYZVYDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8H.
What are the key properties of 9,10-Phenanthrenedione?
9,10-Phenanthrenedione has a molecular weight of 208.21 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-Phenanthrenedione is sourced from PubChem (CID 6763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).