About Dibenzoylmethane
Dibenzoylmethane (PubChem CID 8433) has the molecular formula C15H12O2
and a molecular weight of 224.25 g/mol. Its IUPAC name is 1,3-diphenylpropane-1,3-dione.
Molecular Properties
| Compound Name | Dibenzoylmethane |
| PubChem CID | 8433 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1,3-diphenylpropane-1,3-dione |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C15H12O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | NZZIMKJIVMHWJC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | 243 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze Dibenzoylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dibenzoylmethane?
The IUPAC name of Dibenzoylmethane (CID 8433) is 1,3-diphenylpropane-1,3-dione.
What is the SMILES notation for Dibenzoylmethane?
The canonical SMILES for Dibenzoylmethane is C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=CC=C2.
What is the InChIKey of Dibenzoylmethane?
The InChIKey is NZZIMKJIVMHWJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2.
What are the key properties of Dibenzoylmethane?
Dibenzoylmethane has a molecular weight of 224.25 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Dibenzoylmethane is sourced from PubChem (CID 8433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).