About 1-phenylethanone
1-phenylethanone (PubChem CID 7410) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is 1-phenylethanone.
Molecular Properties
| Compound Name | 1-phenylethanone |
| PubChem CID | 7410 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 1-phenylethanone |
| SMILES | CC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | KWOLFJPFCHCOCG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanone?
The IUPAC name of 1-phenylethanone (CID 7410) is 1-phenylethanone.
What is the SMILES notation for 1-phenylethanone?
The canonical SMILES for 1-phenylethanone is CC(=O)c1ccccc1.
What is the InChIKey of 1-phenylethanone?
The InChIKey is KWOLFJPFCHCOCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of 1-phenylethanone?
1-phenylethanone has a molecular weight of 120.15 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanone is sourced from PubChem (CID 7410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).