About CID 158261979
CID 158261979 (PubChem CID 158261979) has the molecular formula C14H10BrNO2
and a molecular weight of 304.14 g/mol.
Molecular Properties
| Compound Name | CID 158261979 |
| PubChem CID | 158261979 |
| Molecular Formula | C14H10BrNO2 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | — |
| SMILES | NBr.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H8O2.BrH2N/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-2/h1-8H;2H2 |
| InChIKey | GHZBTJHYJWBKEA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 158261979 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158261979?
The IUPAC name of CID 158261979 (CID 158261979) is not available.
What is the SMILES notation for CID 158261979?
The canonical SMILES for CID 158261979 is NBr.O=C1c2ccccc2C(=O)c2ccccc21.
What is the InChIKey of CID 158261979?
The InChIKey is GHZBTJHYJWBKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2.BrH2N/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-2/h1-8H;2H2.
What are the key properties of CID 158261979?
CID 158261979 has a molecular weight of 304.14 g/mol, XLogP of 2.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158261979 is sourced from PubChem (CID 158261979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).