About 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one
1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one (PubChem CID 174089097) has the molecular formula C17H11NO3
and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one.
Molecular Properties
| Compound Name | 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one |
| PubChem CID | 174089097 |
| Molecular Formula | C17H11NO3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one |
| SMILES | O=C1C(C=C2C=NCO2)=C(O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C17H11NO3/c19-16-13-5-10-3-1-2-4-11(10)6-14(13)17(20)15(16)7-12-8-18-9-21-12/h1-8,19H,9H2 |
| InChIKey | DVEGHCPPEKKVMY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one?
The IUPAC name of 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one (CID 174089097) is 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one.
What is the SMILES notation for 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one?
The canonical SMILES for 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one is O=C1C(C=C2C=NCO2)=C(O)c2cc3ccccc3cc21.
What is the InChIKey of 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one?
The InChIKey is DVEGHCPPEKKVMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO3/c19-16-13-5-10-3-1-2-4-11(10)6-14(13)17(20)15(16)7-12-8-18-9-21-12/h1-8,19H,9H2.
What are the key properties of 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one?
1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one has a molecular weight of 277.28 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one is sourced from PubChem (CID 174089097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).