C17H11NO3 — CID 174089097
1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one (PubChem CID 174089097) has the molecular formula C17H11NO3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one.
| Compound Name | 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one |
|---|---|
| PubChem CID | 174089097 |
| Molecular Formula | C17H11NO3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-hydroxy-2-(2H-1,3-oxazol-5-ylidenemethyl)cyclopenta[b]naphthalen-3-one |
| SMILES | O=C1C(C=C2C=NCO2)=C(O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C17H11NO3/c19-16-13-5-10-3-1-2-4-11(10)6-14(13)17(20)15(16)7-12-8-18-9-21-12/h1-8,19H,9H2 |
| InChIKey | DVEGHCPPEKKVMY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|