C26H12N2O3S — CID 170175243
4-[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]furo[2,3-d][1,3]thiazol-2-yl]benzonitrile (PubChem CID 170175243) has the molecular formula C26H12N2O3S and a molecular weight of 432.46 g/mol. Its IUPAC name is 4-[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]furo[2,3-d][1,3]thiazol-2-yl]benzonitrile.
| Compound Name | 4-[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]furo[2,3-d][1,3]thiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 170175243 |
| Molecular Formula | C26H12N2O3S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 4-[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]furo[2,3-d][1,3]thiazol-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3oc(C=C4C(=O)c5cc6ccccc6cc5C4=O)cc3s2)cc1 |
| InChI | InChI=1S/C26H12N2O3S/c27-13-14-5-7-15(8-6-14)26-28-25-22(32-26)12-18(31-25)11-21-23(29)19-9-16-3-1-2-4-17(16)10-20(19)24(21)30/h1-12H |
| InChIKey | ONDFTIVNBBCHLT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 83.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|