C32H17N3O2S — CID 170174815
4-[2-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]-1-phenylthieno[2,3-d]imidazol-5-yl]benzonitrile (PubChem CID 170174815) has the molecular formula C32H17N3O2S and a molecular weight of 507.57 g/mol. Its IUPAC name is 4-[2-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]-1-phenylthieno[2,3-d]imidazol-5-yl]benzonitrile.
| Compound Name | 4-[2-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]-1-phenylthieno[2,3-d]imidazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 170174815 |
| Molecular Formula | C32H17N3O2S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 4-[2-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]-1-phenylthieno[2,3-d]imidazol-5-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc3c(nc(C=C4C(=O)c5cc6ccccc6cc5C4=O)n3-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C32H17N3O2S/c33-18-19-10-12-20(13-11-19)28-17-27-32(38-28)34-29(35(27)23-8-2-1-3-9-23)16-26-30(36)24-14-21-6-4-5-7-22(21)15-25(24)31(26)37/h1-17H |
| InChIKey | TVIPTDWULUXBEQ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|