C37H22N2O3 — CID 168735658
2-[[5-phenyl-1-(4-phenylphenyl)furo[2,3-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168735658) has the molecular formula C37H22N2O3 and a molecular weight of 542.59 g/mol. Its IUPAC name is 2-[[5-phenyl-1-(4-phenylphenyl)furo[2,3-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[5-phenyl-1-(4-phenylphenyl)furo[2,3-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168735658 |
| Molecular Formula | C37H22N2O3 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 2-[[5-phenyl-1-(4-phenylphenyl)furo[2,3-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3oc(-c4ccccc4)cc3n2-c2ccc(-c3ccccc3)cc2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C37H22N2O3/c40-35-29-19-26-13-7-8-14-27(26)20-30(29)36(41)31(35)21-34-38-37-32(22-33(42-37)25-11-5-2-6-12-25)39(34)28-17-15-24(16-18-28)23-9-3-1-4-10-23/h1-22H |
| InChIKey | ALFDIDQWUNFYKU-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|