C30H15Br2N3O3 — CID 168736334
6,7-dibromo-2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168736334) has the molecular formula C30H15Br2N3O3 and a molecular weight of 625.28 g/mol. Its IUPAC name is 6,7-dibromo-2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 6,7-dibromo-2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168736334 |
| Molecular Formula | C30H15Br2N3O3 |
| Molecular Weight | 625.28 g/mol |
| Exact Mass | 622.95 |
| IUPAC Name | 6,7-dibromo-2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3oc(-c4ccccc4)nc3n2-c2ccccc2)C(=O)c2cc3cc(Br)c(Br)cc3cc21 |
| InChI | InChI=1S/C30H15Br2N3O3/c31-23-13-17-11-20-21(12-18(17)14-24(23)32)27(37)22(26(20)36)15-25-33-30-28(35(25)19-9-5-2-6-10-19)34-29(38-30)16-7-3-1-4-8-16/h1-15H |
| InChIKey | FJAVOELDANEQCX-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.28 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|