C31H19N2O3P — CID 170174271
2-[[4-phenyl-2-(4-phosphanylphenyl)pyrrolo[2,3-d][1,3]oxazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 170174271) has the molecular formula C31H19N2O3P and a molecular weight of 498.48 g/mol. Its IUPAC name is 2-[[4-phenyl-2-(4-phosphanylphenyl)pyrrolo[2,3-d][1,3]oxazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[4-phenyl-2-(4-phosphanylphenyl)pyrrolo[2,3-d][1,3]oxazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 170174271 |
| Molecular Formula | C31H19N2O3P |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-[[4-phenyl-2-(4-phosphanylphenyl)pyrrolo[2,3-d][1,3]oxazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2cc3oc(-c4ccc(P)cc4)nc3n2-c2ccccc2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C31H19N2O3P/c34-28-24-14-19-6-4-5-7-20(19)15-25(24)29(35)26(28)16-22-17-27-30(33(22)21-8-2-1-3-9-21)32-31(36-27)18-10-12-23(37)13-11-18/h1-17H,37H2 |
| InChIKey | SUVWKNGYTCAKBF-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|