C28H19N3O3 — CID 168735729
2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]-5,6-dimethylindene-1,3-dione (PubChem CID 168735729) has the molecular formula C28H19N3O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]-5,6-dimethylindene-1,3-dione.
| Compound Name | 2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]-5,6-dimethylindene-1,3-dione |
|---|---|
| PubChem CID | 168735729 |
| Molecular Formula | C28H19N3O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]-5,6-dimethylindene-1,3-dione |
| SMILES | Cc1cc2c(cc1C)C(=O)C(=Cc1nc3oc(-c4ccccc4)nc3n1-c1ccccc1)C2=O |
| InChI | InChI=1S/C28H19N3O3/c1-16-13-20-21(14-17(16)2)25(33)22(24(20)32)15-23-29-28-26(31(23)19-11-7-4-8-12-19)30-27(34-28)18-9-5-3-6-10-18/h3-15H,1-2H3 |
| InChIKey | MDQADNXRWVPOAZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|