C29H15N5O2 — CID 168735975
(2Z)-2-[(2Z)-2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]-3-oxoinden-1-ylidene]-2-isocyanoacetonitrile (PubChem CID 168735975) has the molecular formula C29H15N5O2 and a molecular weight of 465.47 g/mol. Its IUPAC name is (2Z)-2-[(2Z)-2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]-3-oxoinden-1-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[(2Z)-2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]-3-oxoinden-1-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 168735975 |
| Molecular Formula | C29H15N5O2 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | (2Z)-2-[(2Z)-2-[(2,4-diphenylimidazo[4,5-d][1,3]oxazol-5-yl)methylidene]-3-oxoinden-1-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C\c2nc3oc(-c4ccccc4)nc3n2-c2ccccc2)\C(=O)c2ccccc2\1 |
| InChI | InChI=1S/C29H15N5O2/c1-31-23(17-30)25-20-14-8-9-15-21(20)26(35)22(25)16-24-32-29-27(34(24)19-12-6-3-7-13-19)33-28(36-29)18-10-4-2-5-11-18/h2-16H/b22-16-,25-23- |
| InChIKey | RJYLVJLBVCNLIJ-TZLHHXFPSA-N |
| XLogP | 6.11 |
| TPSA | 89.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|