C32H18N6O — CID 168736221
(2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-4-methyl-1-phenylpyrrolo[2,3-d]imidazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile (PubChem CID 168736221) has the molecular formula C32H18N6O and a molecular weight of 502.54 g/mol. Its IUPAC name is (2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-4-methyl-1-phenylpyrrolo[2,3-d]imidazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile.
| Compound Name | (2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-4-methyl-1-phenylpyrrolo[2,3-d]imidazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 168736221 |
| Molecular Formula | C32H18N6O |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | (2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-4-methyl-1-phenylpyrrolo[2,3-d]imidazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C\c2nc3c(cc(-c4ccc([N+]#[C-])cc4)n3C)n2-c2ccccc2)\C(=O)c2ccccc2\1 |
| InChI | InChI=1S/C32H18N6O/c1-34-21-15-13-20(14-16-21)27-18-28-32(37(27)3)36-29(38(28)22-9-5-4-6-10-22)17-25-30(26(19-33)35-2)23-11-7-8-12-24(23)31(25)39/h4-18H,3H3/b25-17-,30-26- |
| InChIKey | KBYWETODEKTZDR-USABXADZSA-N |
| XLogP | 7.02 |
| TPSA | 72.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|