C28H14N6O — CID 168736323
2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(4-methyl-5-phenylpyrrolo[2,3-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile (PubChem CID 168736323) has the molecular formula C28H14N6O and a molecular weight of 450.46 g/mol. Its IUPAC name is 2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(4-methyl-5-phenylpyrrolo[2,3-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(4-methyl-5-phenylpyrrolo[2,3-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 168736323 |
| Molecular Formula | C28H14N6O |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(4-methyl-5-phenylpyrrolo[2,3-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C/c2nc3c(cc(-c4ccccc4)n3C)o2)\C(=C(C#N)C#N)c2ccccc2\1 |
| InChI | InChI=1S/C28H14N6O/c1-32-22(16-31)27-20-11-7-6-10-19(20)26(18(14-29)15-30)21(27)12-25-33-28-24(35-25)13-23(34(28)2)17-8-4-3-5-9-17/h3-13H,2H3/b21-12-,27-22- |
| InChIKey | QPSJBGNBNIOAID-WHIRQMQFSA-N |
| XLogP | 5.89 |
| TPSA | 106.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|