C32H19N3OS — CID 170174852
2-[(2Z)-2-[[4-methyl-5-(4-phenylphenyl)thieno[3,2-b]pyrrol-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 170174852) has the molecular formula C32H19N3OS and a molecular weight of 493.59 g/mol. Its IUPAC name is 2-[(2Z)-2-[[4-methyl-5-(4-phenylphenyl)thieno[3,2-b]pyrrol-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[4-methyl-5-(4-phenylphenyl)thieno[3,2-b]pyrrol-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170174852 |
| Molecular Formula | C32H19N3OS |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-[(2Z)-2-[[4-methyl-5-(4-phenylphenyl)thieno[3,2-b]pyrrol-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | Cn1c(-c2ccc(-c3ccccc3)cc2)cc2sc(/C=C3\C(=O)c4ccccc4C3=C(C#N)C#N)cc21 |
| InChI | InChI=1S/C32H19N3OS/c1-35-28(22-13-11-21(12-14-22)20-7-3-2-4-8-20)17-30-29(35)16-24(37-30)15-27-31(23(18-33)19-34)25-9-5-6-10-26(25)32(27)36/h2-17H,1H3/b27-15- |
| InChIKey | UBZYANHYSXUBPC-DICXZTSXSA-N |
| XLogP | 7.65 |
| TPSA | 69.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|