C27H15F2N3OS2 — CID 176630289
2-[(2Z)-2-[[5-[4-(dimethylamino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]-5,6-difluoro-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 176630289) has the molecular formula C27H15F2N3OS2 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[(2Z)-2-[[5-[4-(dimethylamino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]-5,6-difluoro-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[5-[4-(dimethylamino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]-5,6-difluoro-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 176630289 |
| Molecular Formula | C27H15F2N3OS2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-[(2Z)-2-[[5-[4-(dimethylamino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]-5,6-difluoro-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(-c2cc3sc(/C=C4\C(=O)c5cc(F)c(F)cc5C4=C(C#N)C#N)cc3s2)cc1 |
| InChI | InChI=1S/C27H15F2N3OS2/c1-32(2)16-5-3-14(4-6-16)23-11-25-24(35-23)8-17(34-25)7-20-26(15(12-30)13-31)18-9-21(28)22(29)10-19(18)27(20)33/h3-11H,1-2H3/b20-7- |
| InChIKey | XJHIRNHVKABCKH-SCDVKCJHSA-N |
| XLogP | 7.05 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|