C36H23N5S2 — CID 102370436
2-[3-(dicyanomethylidene)-2-[[5-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]thiophen-2-yl]methylidene]inden-1-ylidene]propanedinitrile (PubChem CID 102370436) has the molecular formula C36H23N5S2 and a molecular weight of 589.75 g/mol. Its IUPAC name is 2-[3-(dicyanomethylidene)-2-[[5-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]thiophen-2-yl]methylidene]inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[3-(dicyanomethylidene)-2-[[5-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]thiophen-2-yl]methylidene]inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102370436 |
| Molecular Formula | C36H23N5S2 |
| Molecular Weight | 589.75 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | 2-[3-(dicyanomethylidene)-2-[[5-[(E)-2-[5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]thiophen-2-yl]ethenyl]thiophen-2-yl]methylidene]inden-1-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(/C=C/c3ccc(C=C4C(=C(C#N)C#N)c5ccccc5C4=C(C#N)C#N)s3)s2)cc1 |
| InChI | InChI=1S/C36H23N5S2/c1-41(2)27-10-7-24(8-11-27)9-12-28-13-14-29(42-28)15-16-30-17-18-31(43-30)19-34-35(25(20-37)21-38)32-5-3-4-6-33(32)36(34)26(22-39)23-40/h3-19H,1-2H3/b12-9+,16-15+ |
| InChIKey | FPPLRENBXKVVRQ-JDHQLRNLSA-N |
| XLogP | 8.92 |
| TPSA | 98.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.75 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|