C36H24N6 — CID 102324628
2-[(2E)-3-(dicyanomethylidene)-2-[[4-(dimethylamino)phenyl]methylidene]-5-(N-phenylanilino)inden-1-ylidene]propanedinitrile (PubChem CID 102324628) has the molecular formula C36H24N6 and a molecular weight of 540.63 g/mol. Its IUPAC name is 2-[(2E)-3-(dicyanomethylidene)-2-[[4-(dimethylamino)phenyl]methylidene]-5-(N-phenylanilino)inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2E)-3-(dicyanomethylidene)-2-[[4-(dimethylamino)phenyl]methylidene]-5-(N-phenylanilino)inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102324628 |
| Molecular Formula | C36H24N6 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-[(2E)-3-(dicyanomethylidene)-2-[[4-(dimethylamino)phenyl]methylidene]-5-(N-phenylanilino)inden-1-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(/C=C2\C(=C(C#N)C#N)c3ccc(N(c4ccccc4)c4ccccc4)cc3C2=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C36H24N6/c1-41(2)28-15-13-25(14-16-28)19-34-35(26(21-37)22-38)32-18-17-31(20-33(32)36(34)27(23-39)24-40)42(29-9-5-3-6-10-29)30-11-7-4-8-12-30/h3-20H,1-2H3/b34-19+ |
| InChIKey | NAPTYHJLZGTNPH-ALQBTCKLSA-N |
| XLogP | 7.92 |
| TPSA | 101.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|