C21H16N4S — CID 27001088
2-[5-[[4-(dimethylamino)phenyl]methylidene]-4-phenyl-1,3-thiazol-2-ylidene]propanedinitrile (PubChem CID 27001088) has the molecular formula C21H16N4S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-[5-[[4-(dimethylamino)phenyl]methylidene]-4-phenyl-1,3-thiazol-2-ylidene]propanedinitrile.
| Compound Name | 2-[5-[[4-(dimethylamino)phenyl]methylidene]-4-phenyl-1,3-thiazol-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 27001088 |
| Molecular Formula | C21H16N4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-[5-[[4-(dimethylamino)phenyl]methylidene]-4-phenyl-1,3-thiazol-2-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(C=c2sc(=C(C#N)C#N)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16N4S/c1-25(2)18-10-8-15(9-11-18)12-19-20(16-6-4-3-5-7-16)24-21(26-19)17(13-22)14-23/h3-12H,1-2H3 |
| InChIKey | YFPJUGAGZFWRSL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|