C24H23N — CID 132506209
N,N-dimethyl-4-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]aniline (PubChem CID 132506209) has the molecular formula C24H23N and a molecular weight of 325.45 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 132506209 |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H23N/c1-25(2)24-18-16-23(17-19-24)15-14-22-12-10-21(11-13-22)9-8-20-6-4-3-5-7-20/h3-19H,1-2H3/b9-8+,15-14+ |
| InChIKey | TUVYKDQGPVGGTH-IDRAWEHWSA-N |
| XLogP | 6.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|