C29H27NO — CID 11036914
[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-diphenylmethanol (PubChem CID 11036914) has the molecular formula C29H27NO and a molecular weight of 405.54 g/mol. Its IUPAC name is [4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-diphenylmethanol.
| Compound Name | [4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-diphenylmethanol |
|---|---|
| PubChem CID | 11036914 |
| Molecular Formula | C29H27NO |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-diphenylmethanol |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(C(O)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H27NO/c1-30(2)28-21-17-24(18-22-28)14-13-23-15-19-27(20-16-23)29(31,25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3-22,31H,1-2H3/b14-13+ |
| InChIKey | DRJMJVVPYZBGFI-BUHFOSPRSA-N |
| XLogP | 6.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|