C20H21N — CID 6015156
N,N-dimethyl-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]aniline (PubChem CID 6015156) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 6015156 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N,N-dimethyl-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/C=C/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N/c1-21(2)20-16-14-19(15-17-20)13-7-4-3-6-10-18-11-8-5-9-12-18/h3-17H,1-2H3/b4-3+,10-6+,13-7+ |
| InChIKey | QNBRWGUCMQGGDA-YPXUENLVSA-N |
| XLogP | 5.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|