C12H14FN — CID 101097546
4-[(1Z,3E)-4-fluorobuta-1,3-dienyl]-N,N-dimethylaniline (PubChem CID 101097546) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is 4-[(1Z,3E)-4-fluorobuta-1,3-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1Z,3E)-4-fluorobuta-1,3-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101097546 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-[(1Z,3E)-4-fluorobuta-1,3-dienyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C\C=C\F)cc1 |
| InChI | InChI=1S/C12H14FN/c1-14(2)12-8-6-11(7-9-12)5-3-4-10-13/h3-10H,1-2H3/b5-3-,10-4+ |
| InChIKey | KPAIRRWODATZGY-FJQHFOHYSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|