C20H23N2+ — CID 20657517
N,N-dimethyl-4-[(1E,3E,5E)-6-(1-methylpyridin-1-ium-4-yl)hexa-1,3,5-trienyl]aniline (PubChem CID 20657517) has the molecular formula C20H23N2+ and a molecular weight of 291.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1E,3E,5E)-6-(1-methylpyridin-1-ium-4-yl)hexa-1,3,5-trienyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1E,3E,5E)-6-(1-methylpyridin-1-ium-4-yl)hexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 20657517 |
| Molecular Formula | C20H23N2+ |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N,N-dimethyl-4-[(1E,3E,5E)-6-(1-methylpyridin-1-ium-4-yl)hexa-1,3,5-trienyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/C=C/C=C/c2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C20H23N2/c1-21(2)20-12-10-18(11-13-20)8-6-4-5-7-9-19-14-16-22(3)17-15-19/h4-17H,1-3H3/q+1 |
| InChIKey | FYDWYWWFFZXLCK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|