C18H21IN2 — CID 45488916
N,N-dimethyl-4-[(1E,3E)-4-(1-methylpyridin-1-ium-4-yl)buta-1,3-dienyl]aniline iodide (PubChem CID 45488916) has the molecular formula C18H21IN2 and a molecular weight of 392.28 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1E,3E)-4-(1-methylpyridin-1-ium-4-yl)buta-1,3-dienyl]aniline iodide.
| Compound Name | N,N-dimethyl-4-[(1E,3E)-4-(1-methylpyridin-1-ium-4-yl)buta-1,3-dienyl]aniline iodide |
|---|---|
| PubChem CID | 45488916 |
| Molecular Formula | C18H21IN2 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N,N-dimethyl-4-[(1E,3E)-4-(1-methylpyridin-1-ium-4-yl)buta-1,3-dienyl]aniline iodide |
| SMILES | CN(C)c1ccc(/C=C/C=C/c2cc[n+](C)cc2)cc1.[I-] |
| InChI | InChI=1S/C18H21N2.HI/c1-19(2)18-10-8-16(9-11-18)6-4-5-7-17-12-14-20(3)15-13-17;/h4-15H,1-3H3;1H/q+1;/p-1 |
| InChIKey | PVQBRDFWVVKMED-UHFFFAOYSA-M |
| XLogP | 0.31 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|