C15H19N2+ — CID 143521893
[(2Z,4E,6E)-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]azanium (PubChem CID 143521893) has the molecular formula C15H19N2+ and a molecular weight of 227.33 g/mol. Its IUPAC name is [(2Z,4E,6E)-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]azanium.
| Compound Name | [(2Z,4E,6E)-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]azanium |
|---|---|
| PubChem CID | 143521893 |
| Molecular Formula | C15H19N2+ |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | [(2Z,4E,6E)-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienylidene]azanium |
| SMILES | CN(C)c1ccc(/C=C/C=C/C=C\C=[NH2+])cc1 |
| InChI | InChI=1S/C15H18N2/c1-17(2)15-11-9-14(10-12-15)8-6-4-3-5-7-13-16/h3-13,16H,1-2H3/p+1/b4-3+,7-5-,8-6+,16-13? |
| InChIKey | KYDCEHNTJINLTM-KOABVLMZSA-O |
| XLogP | 1.71 |
| TPSA | 28.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|