C21H26N2 — CID 58612965
4-[(1E,4E)-5-[4-(dimethylamino)phenyl]penta-1,4-dienyl]-N,N-dimethylaniline (PubChem CID 58612965) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]penta-1,4-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]penta-1,4-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 58612965 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 4-[(1E,4E)-5-[4-(dimethylamino)phenyl]penta-1,4-dienyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C/C=C/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26N2/c1-22(2)20-14-10-18(11-15-20)8-6-5-7-9-19-12-16-21(17-13-19)23(3)4/h6-17H,5H2,1-4H3/b8-6+,9-7+ |
| InChIKey | GRWBTWKTPFFWPD-CDJQDVQCSA-N |
| XLogP | 4.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|