C19H20ClN — CID 58649433
4-[5-(4-chlorophenyl)penta-1,4-dienyl]-N,N-dimethylaniline (PubChem CID 58649433) has the molecular formula C19H20ClN and a molecular weight of 297.83 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)penta-1,4-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[5-(4-chlorophenyl)penta-1,4-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 58649433 |
| Molecular Formula | C19H20ClN |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-[5-(4-chlorophenyl)penta-1,4-dienyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=CCC=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20ClN/c1-21(2)19-14-10-17(11-15-19)7-5-3-4-6-16-8-12-18(20)13-9-16/h4-15H,3H2,1-2H3 |
| InChIKey | YZSVOKYZJRFGEO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|