C11H14N2O — CID 91934001
N,N-dimethyl-4-[(E)-3-nitrosoprop-1-enyl]aniline (PubChem CID 91934001) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-3-nitrosoprop-1-enyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-3-nitrosoprop-1-enyl]aniline |
|---|---|
| PubChem CID | 91934001 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N,N-dimethyl-4-[(E)-3-nitrosoprop-1-enyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/CN=O)cc1 |
| InChI | InChI=1S/C11H14N2O/c1-13(2)11-7-5-10(6-8-11)4-3-9-12-14/h3-8H,9H2,1-2H3/b4-3+ |
| InChIKey | QCRAXSUGRBNOBQ-ONEGZZNKSA-N |
| XLogP | 2.53 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|