C15H23N — CID 101050911
4-[(E)-hept-1-enyl]-N,N-dimethylaniline (PubChem CID 101050911) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 4-[(E)-hept-1-enyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-hept-1-enyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101050911 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 4-[(E)-hept-1-enyl]-N,N-dimethylaniline |
| SMILES | CCCCC/C=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H23N/c1-4-5-6-7-8-9-14-10-12-15(13-11-14)16(2)3/h8-13H,4-7H2,1-3H3/b9-8+ |
| InChIKey | MOONOUKRFRFAGB-CMDGGOBGSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|